Products 1643147-59-4

CAS 1643147-59-4 is the registry number for 6-Imino-2-oxa-6l6-thiaspiro[3.3]heptane 6-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-imino-6-oxa-2lambda6-thiaspiro[3.3]heptane 2-oxide (CAS 1643147-59-4) is a chemical compound with the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. IUPAC name: 2-imino-6-oxa-2lambda6-thiaspiro[3.3]heptane 2-oxide. InChIKey: WERKUZNUAOJADK-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9NO2S
Molecular weight147.20 g/mol
IUPAC name2-imino-6-oxa-2lambda6-thiaspiro[3.3]heptane 2-oxide
InChIKeyWERKUZNUAOJADK-UHFFFAOYSA-N
SMILESC1C2(CO1)CS(=N)(=O)C2

Computed by PubChem (NCBI)