Products 1643358-01-3

CAS 1643358-01-3 is the registry number for Di-tert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate (CAS 1643358-01-3) is a chemical compound with the molecular formula C20H29ClN2O4 and a molecular weight of 396.9 g/mol. IUPAC name: ditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate. InChIKey: XCWWVMIKMXDYJM-UHFFFAOYSA-N.

Identity
Molecular formulaC20H29ClN2O4
Molecular weight396.9 g/mol
IUPAC nameditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate
InChIKeyXCWWVMIKMXDYJM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(C(C1)C2=CC=C(C=C2)Cl)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)