CAS 1643358-01-3 is the registry number for Di-tert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate (CAS 1643358-01-3) is a chemical compound with the molecular formula C20H29ClN2O4 and a molecular weight of 396.9 g/mol. IUPAC name: ditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate. InChIKey: XCWWVMIKMXDYJM-UHFFFAOYSA-N.
| Molecular formula | C20H29ClN2O4 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | ditert-butyl 2-(4-chlorophenyl)piperazine-1,4-dicarboxylate |
| InChIKey | XCWWVMIKMXDYJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C2=CC=C(C=C2)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)