CAS 769944-52-7 is the registry number for 1,4-Bis(1,1-dimethylethyl) (2R)-2-(4-chlorophenyl)-1,4-piperazinedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ditert-butyl (2R)-2-(4-chlorophenyl)piperazine-1,4-dicarboxylate (CAS 769944-52-7) is a chemical compound with the molecular formula C20H29ClN2O4 and a molecular weight of 396.9 g/mol. IUPAC name: ditert-butyl (2R)-2-(4-chlorophenyl)piperazine-1,4-dicarboxylate. InChIKey: XCWWVMIKMXDYJM-INIZCTEOSA-N.
| Molecular formula | C20H29ClN2O4 |
|---|---|
| Molecular weight | 396.9 g/mol |
| IUPAC name | ditert-butyl (2R)-2-(4-chlorophenyl)piperazine-1,4-dicarboxylate |
| InChIKey | XCWWVMIKMXDYJM-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)C2=CC=C(C=C2)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)