Products 1643577-32-5

CAS 1643577-32-5 is the registry number for 4-(Methoxycarbonyl)bromobenzene-2,3,5,6-d4, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2,3,5,6-tetradeuteriobenzoate (CAS 1643577-32-5) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 219.07 g/mol. IUPAC name: methyl 4-bromo-2,3,5,6-tetradeuteriobenzoate. InChIKey: CZNGTXVOZOWWKM-QFFDRWTDSA-N.

Identity
Molecular formulaC8H7BrO2
Molecular weight219.07 g/mol
IUPAC namemethyl 4-bromo-2,3,5,6-tetradeuteriobenzoate
InChIKeyCZNGTXVOZOWWKM-QFFDRWTDSA-N
SMILES[2H]C1=C(C(=C(C(=C1C(=O)OC)[2H])[2H])Br)[2H]

Computed by PubChem (NCBI)