CAS 1643577-32-5 is the registry number for 4-(Methoxycarbonyl)bromobenzene-2,3,5,6-d4, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Methyl 4-bromo-2,3,5,6-tetradeuteriobenzoate (CAS 1643577-32-5) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 219.07 g/mol. IUPAC name: methyl 4-bromo-2,3,5,6-tetradeuteriobenzoate. InChIKey: CZNGTXVOZOWWKM-QFFDRWTDSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 219.07 g/mol |
| IUPAC name | methyl 4-bromo-2,3,5,6-tetradeuteriobenzoate |
| InChIKey | CZNGTXVOZOWWKM-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OC)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)