CAS 79825-72-2 is the registry number for Methyl–d3 bromophenyl–4–carboxylate. Offered by: GLPBio. Available pack sizes: 20mg.
Trideuteriomethyl 4-bromobenzoate (CAS 79825-72-2) is a chemical compound with the molecular formula C8H7BrO2 and a molecular weight of 218.06 g/mol. IUPAC name: trideuteriomethyl 4-bromobenzoate. InChIKey: CZNGTXVOZOWWKM-FIBGUPNXSA-N.
| Molecular formula | C8H7BrO2 |
|---|---|
| Molecular weight | 218.06 g/mol |
| IUPAC name | trideuteriomethyl 4-bromobenzoate |
| InChIKey | CZNGTXVOZOWWKM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)