CAS 1643808-81-4 is the registry number for (4-(Benzyloxy)phenyl)(6-bromopyridin-3-yl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-bromo-3-pyridinyl)-(4-phenylmethoxyphenyl)methanone (CAS 1643808-81-4) is a chemical compound with the molecular formula C19H14BrNO2 and a molecular weight of 368.2 g/mol. IUPAC name: (6-bromo-3-pyridinyl)-(4-phenylmethoxyphenyl)methanone. InChIKey: WFXDKSUQUFAPAL-UHFFFAOYSA-N.
| Molecular formula | C19H14BrNO2 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | (6-bromo-3-pyridinyl)-(4-phenylmethoxyphenyl)methanone |
| InChIKey | WFXDKSUQUFAPAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=O)C3=CN=C(C=C3)Br |
Computed by PubChem (NCBI)