CAS 926234-21-1 is the registry number for 6-Bromo-2-(2-(2-methylphenyl)ethenyl)quinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-bromo-2-[(E)-2-(2-methylphenyl)ethenyl]quinoline-4-carboxylic acid (CAS 926234-21-1) is a chemical compound with the molecular formula C19H14BrNO2 and a molecular weight of 368.2 g/mol. IUPAC name: 6-bromo-2-[(E)-2-(2-methylphenyl)ethenyl]quinoline-4-carboxylic acid. InChIKey: DHHUOFDWNDPKDE-SOFGYWHQSA-N.
| Molecular formula | C19H14BrNO2 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | 6-bromo-2-[(E)-2-(2-methylphenyl)ethenyl]quinoline-4-carboxylic acid |
| InChIKey | DHHUOFDWNDPKDE-SOFGYWHQSA-N |
| SMILES | CC1=CC=CC=C1/C=C/C2=CC(=C3C=C(C=CC3=N2)Br)C(=O)O |
Computed by PubChem (NCBI)