CAS 1643957-26-9 appears in our catalog under these names: Benzyl-peg3-ch2co2tbu, 95%, Benzyl–PEG2–CH2–Boc, Benzyl-peg3-ch2co2tbu 99%, tert-Butyl 2-(2-(2-(benzyloxy)ethoxy)ethoxy)acetate, 99%, 99%, Benzyl-PEG2-CH2-Boc, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 500 mg, 100 mg, 1 g.
Tert-butyl 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetate (CAS 1643957-26-9) is a chemical compound with the molecular formula C17H26O5 and a molecular weight of 310.4 g/mol. IUPAC name: tert-butyl 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetate. InChIKey: IGVRCUZLYJDPKK-UHFFFAOYSA-N.
| Molecular formula | C17H26O5 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | tert-butyl 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetate |
| InChIKey | IGVRCUZLYJDPKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCC1=CC=CC=C1 |
Computed by PubChem (NCBI)