Products 19198-75-5

CAS 19198-75-5 is the registry number for Decyl gallate. Offered by: Biosynth. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Decyl 3,4,5-trihydroxybenzoate (CAS 19198-75-5) is a chemical compound with the molecular formula C17H26O5 and a molecular weight of 310.4 g/mol. IUPAC name: decyl 3,4,5-trihydroxybenzoate. InChIKey: AOTRKUOCGUXQCY-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26O5
Molecular weight310.4 g/mol
IUPAC namedecyl 3,4,5-trihydroxybenzoate
InChIKeyAOTRKUOCGUXQCY-UHFFFAOYSA-N
SMILESCCCCCCCCCCOC(=O)C1=CC(=C(C(=C1)O)O)O

Computed by PubChem (NCBI)