CAS 1643979-48-9 is the registry number for 1-Pyrrolidinecarboxylic acid, 3-amino-4-phenyl-, 1,1-dimethylethyl ester, (3S,4R)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl (3S,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate (CAS 1643979-48-9) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate. InChIKey: UEGLRNLEEDBVTH-QWHCGFSZSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-phenylpyrrolidine-1-carboxylate |
| InChIKey | UEGLRNLEEDBVTH-QWHCGFSZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)