Products 1644244-99-4

CAS 1644244-99-4 is the registry number for 1-Bromo-4-isopropoxy-2,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene (CAS 1644244-99-4) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene. InChIKey: IYFKJGUTUJCMNI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15BrO
Molecular weight243.14 g/mol
IUPAC name1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene
InChIKeyIYFKJGUTUJCMNI-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Br)C)OC(C)C

Computed by PubChem (NCBI)