CAS 1644244-99-4 is the registry number for 1-Bromo-4-isopropoxy-2,5-dimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene (CAS 1644244-99-4) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene. InChIKey: IYFKJGUTUJCMNI-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 1-bromo-2,5-dimethyl-4-propan-2-yloxybenzene |
| InChIKey | IYFKJGUTUJCMNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)OC(C)C |
Computed by PubChem (NCBI)