Products 1644276-58-3
CAS 1644276-58-3 is the registry number for tert-Butyl (5-((3-fluorophenyl)(hydroxy)methyl)thiazol-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[5-[(3-fluorophenyl)-hydroxymethyl]-1,3-thiazol-2-yl]carbamate (CAS 1644276-58-3) is a chemical compound with the molecular formula C15H17FN2O3S and a molecular weight of 324.4 g/mol. IUPAC name: tert-butyl N-[5-[(3-fluorophenyl)-hydroxymethyl]-1,3-thiazol-2-yl]carbamate. InChIKey: LWZFCFAKUFJRSJ-UHFFFAOYSA-N.
| Molecular formula | C15H17FN2O3S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | tert-butyl N-[5-[(3-fluorophenyl)-hydroxymethyl]-1,3-thiazol-2-yl]carbamate |
| InChIKey | LWZFCFAKUFJRSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(S1)C(C2=CC(=CC=C2)F)O |
Computed by PubChem (NCBI)