CAS 849470-59-3 is the registry number for 4-(4-Fluorophenyl)-5-hydroxymethyl-6-isopropyl-2-methylsulfonylpyrimidine. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
[4-(4-fluorophenyl)-2-methylsulfonyl-6-propan-2-ylpyrimidin-5-yl]methanol (CAS 849470-59-3) is a chemical compound with the molecular formula C15H17FN2O3S and a molecular weight of 324.4 g/mol. IUPAC name: [4-(4-fluorophenyl)-2-methylsulfonyl-6-propan-2-ylpyrimidin-5-yl]methanol. InChIKey: IXKRYFDCDOFCFM-UHFFFAOYSA-N.
| Molecular formula | C15H17FN2O3S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | [4-(4-fluorophenyl)-2-methylsulfonyl-6-propan-2-ylpyrimidin-5-yl]methanol |
| InChIKey | IXKRYFDCDOFCFM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1CO)C2=CC=C(C=C2)F)S(=O)(=O)C |
Computed by PubChem (NCBI)