CAS 1644503-10-5 appears in our catalog under these names: [2-(2,5-Dichloro-pyrimidin-4-ylamino)-phenyl]-oxo-acetic acid, 95%, 2-(2-((2,5-Dichloropyrimidin-4-yl)amino)phenyl)-2-oxoacetic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2-[2-[(2,5-dichloropyrimidin-4-yl)amino]phenyl]-2-oxoacetic acid (CAS 1644503-10-5) is a chemical compound with the molecular formula C12H7Cl2N3O3 and a molecular weight of 312.10 g/mol. IUPAC name: 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]phenyl]-2-oxoacetic acid. InChIKey: AHJUAULPZXKDGV-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O3 |
|---|---|
| Molecular weight | 312.10 g/mol |
| IUPAC name | 2-[2-[(2,5-dichloropyrimidin-4-yl)amino]phenyl]-2-oxoacetic acid |
| InChIKey | AHJUAULPZXKDGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(=O)O)NC2=NC(=NC=C2Cl)Cl |
Computed by PubChem (NCBI)