CAS 55936-43-1 is the registry number for 2,6-Dichloro-4-(4-Nitrophenylazo)phenol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2,6-dichloro-4-[(4-nitrophenyl)diazenyl]phenol (CAS 55936-43-1) is a chemical compound with the molecular formula C12H7Cl2N3O3 and a molecular weight of 312.10 g/mol. IUPAC name: 2,6-dichloro-4-[(4-nitrophenyl)diazenyl]phenol. InChIKey: RGJVSRRBVKQGLM-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O3 |
|---|---|
| Molecular weight | 312.10 g/mol |
| IUPAC name | 2,6-dichloro-4-[(4-nitrophenyl)diazenyl]phenol |
| InChIKey | RGJVSRRBVKQGLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=C(C(=C2)Cl)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)