CAS 1646323-60-5 appears in our catalog under these names: 3'-(9H-Carbazol-9-yl)-[1,1'-biphenyl]-3,5-dicarbonitrile, 99%, Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with dimethylphenyl. Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
5-(3-carbazol-9-ylphenyl)benzene-1,3-dicarbonitrile (CAS 1646323-60-5) is a chemical compound with the molecular formula C26H15N3 and a molecular weight of 369.4 g/mol. IUPAC name: 5-(3-carbazol-9-ylphenyl)benzene-1,3-dicarbonitrile. InChIKey: ILVQOYJGGTXOJS-UHFFFAOYSA-N.
| Molecular formula | C26H15N3 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-(3-carbazol-9-ylphenyl)benzene-1,3-dicarbonitrile |
| InChIKey | ILVQOYJGGTXOJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC(=C4)C5=CC(=CC(=C5)C#N)C#N |
Computed by PubChem (NCBI)