CAS 2234893-85-5 is the registry number for Poly((9,9-dioctyl-2,7-divinylenefluorenylene)-alt-(4,4'-biphenylene)). Offered by: Lumtec. Available pack sizes: On request.
5-(9-phenylcarbazol-3-yl)benzene-1,3-dicarbonitrile (CAS 2234893-85-5) is a chemical compound with the molecular formula C26H15N3 and a molecular weight of 369.4 g/mol. IUPAC name: 5-(9-phenylcarbazol-3-yl)benzene-1,3-dicarbonitrile. InChIKey: NVXLUVDRJAZGKZ-UHFFFAOYSA-N.
| Molecular formula | C26H15N3 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 5-(9-phenylcarbazol-3-yl)benzene-1,3-dicarbonitrile |
| InChIKey | NVXLUVDRJAZGKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC(=CC(=C4)C#N)C#N)C5=CC=CC=C52 |
Computed by PubChem (NCBI)