Products 164648-76-4
CAS 164648-76-4 appears in our catalog under these names: 4-(Aminomethyl)-n,n-dimethylbenzamide, 4-(Aminomethyl)-N,N-dimethylbenzamide, 97%, 4-(Aminomethyl)-N,N-dimethylbenzamide, 98%, 4-(Aminomethyl)-n,n-dimethylbenzamide hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 250mg, 10g, 25g.
4-(aminomethyl)-N,N-dimethylbenzamide (CAS 164648-76-4) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 4-(aminomethyl)-N,N-dimethylbenzamide. InChIKey: FYWRKAATFPEAEF-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-dimethylbenzamide |
| InChIKey | FYWRKAATFPEAEF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)