Products 164650-45-7
CAS 164650-45-7 appears in our catalog under these names: Efinaconazole Impurity 13, Efinaconazole Impurity 38, Efinaconazole Impurity 19, ent-Efinaconazole. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3S)-2-(2,4-difluorophenyl)-3-(4-methylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 164650-45-7) is a chemical compound with the molecular formula C18H22F2N4O and a molecular weight of 348.4 g/mol. IUPAC name: (2S,3S)-2-(2,4-difluorophenyl)-3-(4-methylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: NFEZZTICAUWDHU-KSSFIOAISA-N.
| Molecular formula | C18H22F2N4O |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (2S,3S)-2-(2,4-difluorophenyl)-3-(4-methylidenepiperidin-1-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | NFEZZTICAUWDHU-KSSFIOAISA-N |
| SMILES | C[C@@H]([C@@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)N3CCC(=C)CC3 |
Computed by PubChem (NCBI)