Products 1646565-83-4
CAS 1646565-83-4 is the registry number for (R)-1-(3-Bromo-2-chlorophenyl)ethan-1-amine (hydrochloride), 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(3-bromo-2-chlorophenyl)ethanamine (CAS 1646565-83-4) is a chemical compound with the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. IUPAC name: (1R)-1-(3-bromo-2-chlorophenyl)ethanamine. InChIKey: MIMATNXERJWKQX-RXMQYKEDSA-N.
| Molecular formula | C8H9BrClN |
|---|---|
| Molecular weight | 234.52 g/mol |
| IUPAC name | (1R)-1-(3-bromo-2-chlorophenyl)ethanamine |
| InChIKey | MIMATNXERJWKQX-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C(=CC=C1)Br)Cl)N |
Computed by PubChem (NCBI)