CAS 1646566-74-6 appears in our catalog under these names: (2S)-2-Amino-2-(5-bromo-3-fluorophenyl)ethan-1-ol hydrochloride, 95%, (S)-2-AMINO-2-(3-BROMO-5-FLUOROPHENYL)ETHAN-1-OL HCL, 98%, 98%, (S)-2-AMINO-2-(3-BROMO-5-FLUOROPHENYL)ETHAN-1-OL HCL, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-2-amino-2-(3-bromo-5-fluorophenyl)ethanol;hydrochloride (CAS 1646566-74-6) is a chemical compound with the molecular formula C8H10BrClFNO and a molecular weight of 270.52 g/mol. IUPAC name: (2S)-2-amino-2-(3-bromo-5-fluorophenyl)ethanol;hydrochloride. InChIKey: MZNVVHMLVIIIBD-DDWIOCJRSA-N.
| Molecular formula | C8H10BrClFNO |
|---|---|
| Molecular weight | 270.52 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-bromo-5-fluorophenyl)ethanol;hydrochloride |
| InChIKey | MZNVVHMLVIIIBD-DDWIOCJRSA-N |
| SMILES | C1=C(C=C(C=C1F)Br)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)