CAS 2833040-80-3 is the registry number for ((4-Bromo-2-fluorophenyl)methoxy)(methyl)amine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
N-[(4-bromo-2-fluorophenyl)methoxy]methanamine;hydrochloride (CAS 2833040-80-3) is a chemical compound with the molecular formula C8H10BrClFNO and a molecular weight of 270.52 g/mol. IUPAC name: N-[(4-bromo-2-fluorophenyl)methoxy]methanamine;hydrochloride. InChIKey: FDFJALJFMCNYGE-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClFNO |
|---|---|
| Molecular weight | 270.52 g/mol |
| IUPAC name | N-[(4-bromo-2-fluorophenyl)methoxy]methanamine;hydrochloride |
| InChIKey | FDFJALJFMCNYGE-UHFFFAOYSA-N |
| SMILES | CNOCC1=C(C=C(C=C1)Br)F.Cl |
Computed by PubChem (NCBI)