CAS 1647113-44-7 is the registry number for 7-(Benzyloxy)-8-bromoquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
8-bromo-7-phenylmethoxyquinoline (CAS 1647113-44-7) is a chemical compound with the molecular formula C16H12BrNO and a molecular weight of 314.18 g/mol. IUPAC name: 8-bromo-7-phenylmethoxyquinoline. InChIKey: GTXZLDCWCDLDLE-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO |
|---|---|
| Molecular weight | 314.18 g/mol |
| IUPAC name | 8-bromo-7-phenylmethoxyquinoline |
| InChIKey | GTXZLDCWCDLDLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C3=C(C=CC=N3)C=C2)Br |
Computed by PubChem (NCBI)