CAS 203564-62-9 is the registry number for (2-Bromophenyl)-(3-methylindol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
(2-bromophenyl)-(3-methylindol-1-yl)methanone (CAS 203564-62-9) is a chemical compound with the molecular formula C16H12BrNO and a molecular weight of 314.18 g/mol. IUPAC name: (2-bromophenyl)-(3-methylindol-1-yl)methanone. InChIKey: XTDJSTKDZHBDQP-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO |
|---|---|
| Molecular weight | 314.18 g/mol |
| IUPAC name | (2-bromophenyl)-(3-methylindol-1-yl)methanone |
| InChIKey | XTDJSTKDZHBDQP-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=CC=CC=C12)C(=O)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)