Products 1648796-40-0
CAS 1648796-40-0 appears in our catalog under these names: Clorprenaline–d6, Clorprenaline-d6, 98.0%, Clorprenaline-d6, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
1-(2-chlorophenyl)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)ethanol (CAS 1648796-40-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 219.74 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)ethanol. InChIKey: SSMSBSWKLKKXGG-WFGJKAKNSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 219.74 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylamino)ethanol |
| InChIKey | SSMSBSWKLKKXGG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])NCC(C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)