CAS 1649454-82-9 is the registry number for (5-(Ethylsulfonyl)pyrimidin-2-yl)methanamine hcl, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(5-ethylsulfonylpyrimidin-2-yl)methanamine;hydrochloride (CAS 1649454-82-9) is a chemical compound with the molecular formula C7H12ClN3O2S and a molecular weight of 237.71 g/mol. IUPAC name: (5-ethylsulfonylpyrimidin-2-yl)methanamine;hydrochloride. InChIKey: PBMMULUINNQSQJ-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN3O2S |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | (5-ethylsulfonylpyrimidin-2-yl)methanamine;hydrochloride |
| InChIKey | PBMMULUINNQSQJ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CN=C(N=C1)CN.Cl |
Computed by PubChem (NCBI)