CAS 1803590-36-4 is the registry number for 1-N-(Methylsulfamoyl)benzene-1,4-diamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-N-(methylsulfamoyl)benzene-1,4-diamine;hydrochloride (CAS 1803590-36-4) is a chemical compound with the molecular formula C7H12ClN3O2S and a molecular weight of 237.71 g/mol. IUPAC name: 4-N-(methylsulfamoyl)benzene-1,4-diamine;hydrochloride. InChIKey: LPLJJTNOOWKEGQ-UHFFFAOYSA-N.
| Molecular formula | C7H12ClN3O2S |
|---|---|
| Molecular weight | 237.71 g/mol |
| IUPAC name | 4-N-(methylsulfamoyl)benzene-1,4-diamine;hydrochloride |
| InChIKey | LPLJJTNOOWKEGQ-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)NC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)