Products 16508-04-6
CAS 16508-04-6 is the registry number for Bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid (CAS 16508-04-6) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid. InChIKey: DVWBKCSKPCZFDE-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | bicyclo[2.2.1]hept-2-ene-2,3-dicarboxylic acid |
| InChIKey | DVWBKCSKPCZFDE-UHFFFAOYSA-N |
| SMILES | C1CC2CC1C(=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)