Products 1651833-51-0
CAS 1651833-51-0 is the registry number for JWH 200-d5. Offered by: Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
Naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(2-morpholin-4-ylethyl)indol-3-yl]methanone (CAS 1651833-51-0) is a chemical compound with the molecular formula C25H24N2O2 and a molecular weight of 389.5 g/mol. IUPAC name: naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(2-morpholin-4-ylethyl)indol-3-yl]methanone. InChIKey: SZWYXJHTNGJPKU-JXQMETBUSA-N.
| Molecular formula | C25H24N2O2 |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(2-morpholin-4-ylethyl)indol-3-yl]methanone |
| InChIKey | SZWYXJHTNGJPKU-JXQMETBUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCN3CCOCC3)[2H])C(=O)C4=CC=CC5=CC=CC=C54)[2H])[2H] |
Computed by PubChem (NCBI)