CAS 850467-66-2 appears in our catalog under these names: N-(2-Oxo-2-((1,2,3,4-tetrahydronaphthalen-1-yl)amino)ethyl)-[1,1'-biphenyl]-4-carboxamide, 99%, 99%, CP 43, TAO Kinase inhibitor 1/ 99.45% (existing batch purity), Compound 43 TAO Kinase Inhibitor, TAO Kinase inhibitor 1. Offered by: Chemat, Chemat Brand, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 100mg, on request, 25mg, 50mg, 500mg.
N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]-4-phenylbenzamide (CAS 850467-66-2) is a chemical compound with the molecular formula C25H24N2O2 and a molecular weight of 384.5 g/mol. IUPAC name: N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]-4-phenylbenzamide. InChIKey: WQKXOAJVNFOHNZ-UHFFFAOYSA-N.
| Molecular formula | C25H24N2O2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | N-[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]-4-phenylbenzamide |
| InChIKey | WQKXOAJVNFOHNZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)NC(=O)CNC(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)