Products 165275-95-6
CAS 165275-95-6 appears in our catalog under these names: tert–Butyl 5–iodopicolinate, tert-Butyl 5-iodopicolinate 97%, tert-Butyl 5-iodopicolinate, 97%, 97%, tert-Butyl 5-iodopicolinate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g.
Tert-butyl 5-iodopyridine-2-carboxylate (CAS 165275-95-6) is a chemical compound with the molecular formula C10H12INO2 and a molecular weight of 305.11 g/mol. IUPAC name: tert-butyl 5-iodopyridine-2-carboxylate. InChIKey: HZMYUTRZBHUYBF-UHFFFAOYSA-N.
| Molecular formula | C10H12INO2 |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | tert-butyl 5-iodopyridine-2-carboxylate |
| InChIKey | HZMYUTRZBHUYBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC=C(C=C1)I |
Computed by PubChem (NCBI)