CAS 165317-79-3 is the registry number for 4-(4-Chlorophenyl)-3-cyclohexene-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 5g.
4-(4-chlorophenyl)cyclohex-3-ene-1-carboxylic acid (CAS 165317-79-3) is a chemical compound with the molecular formula C13H13ClO2 and a molecular weight of 236.69 g/mol. IUPAC name: 4-(4-chlorophenyl)cyclohex-3-ene-1-carboxylic acid. InChIKey: PUEVPYKWPGVGGE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClO2 |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | 4-(4-chlorophenyl)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | PUEVPYKWPGVGGE-UHFFFAOYSA-N |
| SMILES | C1CC(=CCC1C(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)