Products 2919215-91-9
CAS 2919215-91-9 is the registry number for 1-Chloro-2-cyclopropyl-3-ethynyl-5-(methoxymethoxy)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-cyclopropyl-3-ethynyl-5-(methoxymethoxy)benzene (CAS 2919215-91-9) is a chemical compound with the molecular formula C13H13ClO2 and a molecular weight of 236.69 g/mol. IUPAC name: 1-chloro-2-cyclopropyl-3-ethynyl-5-(methoxymethoxy)benzene. InChIKey: QTBJLYDUMMDUFQ-UHFFFAOYSA-N.
| Molecular formula | C13H13ClO2 |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | 1-chloro-2-cyclopropyl-3-ethynyl-5-(methoxymethoxy)benzene |
| InChIKey | QTBJLYDUMMDUFQ-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C(=C1)Cl)C2CC2)C#C |
Computed by PubChem (NCBI)