CAS 1655-43-2 appears in our catalog under these names: Disodium 1,6–Naphthalenedisulfonate, Disodium 1,6-Naphthalenedisulfonate, >98.0%(HPLC)(T), 1,6-Naphthalenedisulfonic acid disodium salt, Sodium naphthalene-1,6-disulfonate 97%, 1,6-Naphthalenedisulfonic acid, sodium salt (1:2), 97%, 97%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 500g, 1g, 2kg, 5kg, 10kg, 25kg, 100g, 1000g.
Disodium;naphthalene-1,6-disulfonate (CAS 1655-43-2) is a chemical compound with the molecular formula C10H6Na2O6S2 and a molecular weight of 332.3 g/mol. IUPAC name: disodium;naphthalene-1,6-disulfonate. InChIKey: FXJFYEOXUWERCL-UHFFFAOYSA-L.
| Molecular formula | C10H6Na2O6S2 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | disodium;naphthalene-1,6-disulfonate |
| InChIKey | FXJFYEOXUWERCL-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)[O-])C(=C1)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)