CAS 1655-45-4 appears in our catalog under these names: Sodium Naphthalene-2,6-disulfonate, Disodium 2,6–Naphthalenedisulfonate, Disodium 2,6-Naphthalenedisulfonate, >90.0%(T), 2,6-Naphthalenedisulfonic acid disodium, Sodium naphthalene-2,6-disulfonate 97%. Offered by: TRC, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 10g, 50g, 5g, 500g, 25g, 0,5kg, 100g, 1000g.
Disodium;naphthalene-2,6-disulfonate (CAS 1655-45-4) is a chemical compound with the molecular formula C10H6Na2O6S2 and a molecular weight of 332.3 g/mol. IUPAC name: disodium;naphthalene-2,6-disulfonate. InChIKey: WZZLWPIYWZEJOX-UHFFFAOYSA-L.
| Molecular formula | C10H6Na2O6S2 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | disodium;naphthalene-2,6-disulfonate |
| InChIKey | WZZLWPIYWZEJOX-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=CC(=C2)S(=O)(=O)[O-])C=C1S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)