CAS 1655488-82-6 is the registry number for 1-((1,3-Dimethyl-1H-indazol-5-yl)amino)cyclobutane-1-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1,3-dimethylindazol-5-yl)amino]cyclobutane-1-carbonitrile (CAS 1655488-82-6) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 1-[(1,3-dimethylindazol-5-yl)amino]cyclobutane-1-carbonitrile. InChIKey: UQPQECALFMVQSR-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-[(1,3-dimethylindazol-5-yl)amino]cyclobutane-1-carbonitrile |
| InChIKey | UQPQECALFMVQSR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=C2)NC3(CCC3)C#N)C |
Computed by PubChem (NCBI)