CAS 539-17-3 appears in our catalog under these names: N,N-Dimethyl-4,4'-azodianiline, 95%, N,N-Dimethyl-4,4-azodianiline, 98%, 4–Amino–4'–dimethylaminoazobenzene, 4-Amino-4'-dimethylaminoazobenzene, >97.0%(HPLC)(T), N,N-Dimethyl-4,4-azodianiline, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 200mg, 2g.
4-[[4-(dimethylamino)phenyl]diazenyl]aniline (CAS 539-17-3) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]aniline. InChIKey: BVRIUXYMUSKBHG-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]aniline |
| InChIKey | BVRIUXYMUSKBHG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)