CAS 165669-32-9 appears in our catalog under these names: 4-(Pyrrolidin-1-ylsulfonyl)benzenesulfonyl chloride, 95%, 4-(Pyrrolidine-1-sulfonyl)-benzenesulfonyl chloride, Tech. . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 5g, 10g, 1g, 250MG.
4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride (CAS 165669-32-9) is a chemical compound with the molecular formula C10H12ClNO4S2 and a molecular weight of 309.8 g/mol. IUPAC name: 4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride. InChIKey: ZXYZKIFFWKXROK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4S2 |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylsulfonylbenzenesulfonyl chloride |
| InChIKey | ZXYZKIFFWKXROK-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)