CAS 174139-72-1 appears in our catalog under these names: Brinzolamide Impurity 22, Brinzolamide Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-(3-methoxypropyl)-1,1-dioxo-3H-thieno[3,2-e]thiazin-4-one (CAS 174139-72-1) is a chemical compound with the molecular formula C10H12ClNO4S2 and a molecular weight of 309.8 g/mol. IUPAC name: 6-chloro-2-(3-methoxypropyl)-1,1-dioxo-3H-thieno[3,2-e]thiazin-4-one. InChIKey: ZMPQRODWIGQDNJ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4S2 |
|---|---|
| Molecular weight | 309.8 g/mol |
| IUPAC name | 6-chloro-2-(3-methoxypropyl)-1,1-dioxo-3H-thieno[3,2-e]thiazin-4-one |
| InChIKey | ZMPQRODWIGQDNJ-UHFFFAOYSA-N |
| SMILES | COCCCN1CC(=O)C2=C(S1(=O)=O)SC(=C2)Cl |
Computed by PubChem (NCBI)