CAS 165686-44-2 is the registry number for Indeno[2,1-c]pyrazol-8(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3H-indeno[1,2-d]pyrazol-4-one (CAS 165686-44-2) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 3H-indeno[1,2-d]pyrazol-4-one. InChIKey: BPMLDDSWSPCZKS-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 3H-indeno[1,2-d]pyrazol-4-one |
| InChIKey | BPMLDDSWSPCZKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)NN=C3 |
Computed by PubChem (NCBI)