CAS 1657-56-3 appears in our catalog under these names: 4,4'-Dichloro-trans-stilbene, 95%, 4,4'–Dichloro–trans–stilbene, 4,4'-Dichloro-trans-stilbene, >98.0%(GC), (E)-1,2-Bis(4-chlorophenyl)ethene 95%, (E)-1,2-Bis(4-chlorophenyl)ethene, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene (CAS 1657-56-3) is a chemical compound with the molecular formula C14H10Cl2 and a molecular weight of 249.1 g/mol. IUPAC name: 1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene. InChIKey: WELCIURRBCOJDX-OWOJBTEDSA-N.
| Molecular formula | C14H10Cl2 |
|---|---|
| Molecular weight | 249.1 g/mol |
| IUPAC name | 1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene |
| InChIKey | WELCIURRBCOJDX-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)