CAS 5121-74-4 appears in our catalog under these names: 1,2-Bis(4-chlorophenyl)ethene 95%, 1,2-Bis(4-chlorophenyl)ethene, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene (CAS 5121-74-4) is a chemical compound with the molecular formula C14H10Cl2 and a molecular weight of 249.1 g/mol. IUPAC name: 1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene. InChIKey: WELCIURRBCOJDX-OWOJBTEDSA-N.
| Molecular formula | C14H10Cl2 |
|---|---|
| Molecular weight | 249.1 g/mol |
| IUPAC name | 1-chloro-4-[(E)-2-(4-chlorophenyl)ethenyl]benzene |
| InChIKey | WELCIURRBCOJDX-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)