Products 1658-97-5
CAS 1658-97-5 is the registry number for 4-Acetyl-N,N-diethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-acetyl-N,N-diethylbenzenesulfonamide (CAS 1658-97-5) is a chemical compound with the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. IUPAC name: 4-acetyl-N,N-diethylbenzenesulfonamide. InChIKey: OKAAHYQTIYWBEL-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 4-acetyl-N,N-diethylbenzenesulfonamide |
| InChIKey | OKAAHYQTIYWBEL-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(=O)C |
Computed by PubChem (NCBI)