Products 165803-61-2

CAS 165803-61-2 is the registry number for 3-(2-Bromophenyl)propyl methanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

3-(2-bromophenyl)propyl methanesulfonate (CAS 165803-61-2) is a chemical compound with the molecular formula C10H13BrO3S and a molecular weight of 293.18 g/mol. IUPAC name: 3-(2-bromophenyl)propyl methanesulfonate. InChIKey: VYMPNASDUNFWDY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BrO3S
Molecular weight293.18 g/mol
IUPAC name3-(2-bromophenyl)propyl methanesulfonate
InChIKeyVYMPNASDUNFWDY-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCCC1=CC=CC=C1Br

Computed by PubChem (NCBI)