CAS 403793-29-3 appears in our catalog under these names: 1–bromo–4–((3–methoxypropyl)sulfonyl)benzene, 1-Bromo-4-((3-methoxypropyl)sulfonyl)benzene, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-(3-methoxypropylsulfonyl)benzene (CAS 403793-29-3) is a chemical compound with the molecular formula C10H13BrO3S and a molecular weight of 293.18 g/mol. IUPAC name: 1-bromo-4-(3-methoxypropylsulfonyl)benzene. InChIKey: SFRFMJYOARYANS-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO3S |
|---|---|
| Molecular weight | 293.18 g/mol |
| IUPAC name | 1-bromo-4-(3-methoxypropylsulfonyl)benzene |
| InChIKey | SFRFMJYOARYANS-UHFFFAOYSA-N |
| SMILES | COCCCS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)