Products 1658458-26-4
CAS 1658458-26-4 is the registry number for (2S)-Ac4GalNAl. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate (CAS 1658458-26-4) is a chemical compound with the molecular formula C19H25NO10 and a molecular weight of 427.4 g/mol. IUPAC name: [(2R,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate. InChIKey: PODQGPKRSTUNAT-FTWQHDNSSA-N.
| Molecular formula | C19H25NO10 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate |
| InChIKey | PODQGPKRSTUNAT-FTWQHDNSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC(=O)C)NC(=O)CCC#C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)