CAS 1810852-60-8 appears in our catalog under these names: (3R,4R,5R,6R)-6-(Acetoxymethyl)-3-(pent-4-ynamido)tetrahydro-2H-pyran-2,4,5-triyl triacetate, 95%, Ac4GalNAlk, 98.9%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 10 mg, 5 mg.
[(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate (CAS 1810852-60-8) is a chemical compound with the molecular formula C19H25NO10 and a molecular weight of 427.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate. InChIKey: PODQGPKRSTUNAT-ILNABNIYSA-N.
| Molecular formula | C19H25NO10 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-(pent-4-ynoylamino)oxan-2-yl]methyl acetate |
| InChIKey | PODQGPKRSTUNAT-ILNABNIYSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC(=O)C)NC(=O)CCC#C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)