Products 16604-45-8
CAS 16604-45-8 is the registry number for Medifoxamine fumarate. Offered by: TargetMol. Available pack sizes: 25mg, 50mg, 100mg.
(E)-but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine (CAS 16604-45-8) is a chemical compound with the molecular formula C20H23NO6 and a molecular weight of 373.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine. InChIKey: CSQUJXBMSDQIKM-WLHGVMLRSA-N.
| Molecular formula | C20H23NO6 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine |
| InChIKey | CSQUJXBMSDQIKM-WLHGVMLRSA-N |
| SMILES | CN(C)CC(OC1=CC=CC=C1)OC2=CC=CC=C2.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cledial, MEDIFOXAMINE FUMARATE, Geraxyl, N,N-Dimethyl-N-(2,2-diphenoxyethyl)amine fumarate, (E)-but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine, orb1701948, (E)-but-2-enedioate;2,2-diphenoxyethyl(dimethyl)azanium, CSQUJXBMSDQIKM-WLHGVMLRSA-N, MEDIFOXAMINE FUMARATE [MI], MEDIFOXAMINE FUMARATE [WHO-DD]