Products 1826337-40-9
CAS 1826337-40-9 is the registry number for S07-2005 (racemic). Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[(6-ethoxy-3,4-dihydro-2H-chromene-3-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid (CAS 1826337-40-9) is a chemical compound with the molecular formula C20H23NO6 and a molecular weight of 373.4 g/mol. IUPAC name: 5-[[(6-ethoxy-3,4-dihydro-2H-chromene-3-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid. InChIKey: HTYBIMSPDCMSCK-UHFFFAOYSA-N.
| Molecular formula | C20H23NO6 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 5-[[(6-ethoxy-3,4-dihydro-2H-chromene-3-carbonyl)-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| InChIKey | HTYBIMSPDCMSCK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)OCC(C2)C(=O)N(C)CC3=CC(=C(O3)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
S07-2005 (racemic), orb1688524