Products 1660976-93-1
CAS 1660976-93-1 appears in our catalog under these names: Geraniol–d6 (Major), Geraniol-D6, Geraniol-D6 (Major), Geraniol-d6 (Major), 95.25%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 50mg, 10mg, 25mg, 5mg, 500μg, 1 mg, 500 μg.
(2E)-2,4,4-trideuterio-7-methyl-3-(trideuteriomethyl)octa-2,6-dien-1-ol (CAS 1660976-93-1) is a chemical compound with the molecular formula C10H18O and a molecular weight of 160.29 g/mol. IUPAC name: (2E)-2,4,4-trideuterio-7-methyl-3-(trideuteriomethyl)octa-2,6-dien-1-ol. InChIKey: GLZPCOQZEFWAFX-ATDUBDHSSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 160.29 g/mol |
| IUPAC name | (2E)-2,4,4-trideuterio-7-methyl-3-(trideuteriomethyl)octa-2,6-dien-1-ol |
| InChIKey | GLZPCOQZEFWAFX-ATDUBDHSSA-N |
| SMILES | [2H]/C(=C(/C([2H])([2H])[2H])\C([2H])([2H])CC=C(C)C)/CO |
Computed by PubChem (NCBI)